# -*- coding: utf-8 -*- # PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN: # https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code from ccxt.async_support.base.exchange import Exchange from ccxt.abstract.btcalpha import ImplicitAPI import hashlib from ccxt.base.types import Any, Balances, Currency, IndexType, Int, Market, Num, Order, OrderBook, OrderSide, OrderType, Str, Strings, Ticker, Tickers, Trade, Transaction from typing import List from ccxt.base.errors import ExchangeError from ccxt.base.errors import InsufficientFunds from ccxt.base.errors import InvalidOrder from ccxt.base.decimal_to_precision import TICK_SIZE from ccxt.base.precise import Precise class btcalpha(Exchange, ImplicitAPI): def describe(self) -> Any: return self.deep_extend(super(btcalpha, self).describe(), { 'id': 'btcalpha', 'name': 'BTC-Alpha', 'countries': ['US'], 'version': 'v1', 'has': { 'CORS': None, 'spot': True, 'margin': False, 'swap': False, 'future': False, 'option': False, 'addMargin': False, 'borrowCrossMargin': False, 'borrowIsolatedMargin': False, 'borrowMargin': False, 'cancelOrder': True, 'closeAllPositions': False, 'closePosition': False, 'createDepositAddress': False, 'createOrder': True, 'createOrderWithTakeProfitAndStopLoss': False, 'createOrderWithTakeProfitAndStopLossWs': False, 'createPostOnlyOrder': False, 'createReduceOnlyOrder': False, 'createStopLimitOrder': False, 'createStopMarketOrder': False, 'createStopOrder': False, 'fetchBalance': True, 'fetchBorrowInterest': False, 'fetchBorrowRate': False, 'fetchBorrowRateHistories': False, 'fetchBorrowRateHistory': False, 'fetchBorrowRates': False, 'fetchBorrowRatesPerSymbol': False, 'fetchClosedOrders': True, 'fetchCrossBorrowRate': False, 'fetchCrossBorrowRates': False, 'fetchCurrencies': False, 'fetchDeposit': False, 'fetchDepositAddress': False, 'fetchDepositAddresses': False, 'fetchDepositAddressesByNetwork': False, 'fetchDeposits': True, 'fetchFundingHistory': False, 'fetchFundingInterval': False, 'fetchFundingIntervals': False, 'fetchFundingRate': False, 'fetchFundingRateHistory': False, 'fetchFundingRates': False, 'fetchGreeks': False, 'fetchIndexOHLCV': False, 'fetchIsolatedBorrowRate': False, 'fetchIsolatedBorrowRates': False, 'fetchIsolatedPositions': False, 'fetchL2OrderBook': True, 'fetchLeverage': False, 'fetchLeverages': False, 'fetchLeverageTiers': False, 'fetchLiquidations': False, 'fetchLongShortRatio': False, 'fetchLongShortRatioHistory': False, 'fetchMarginAdjustmentHistory': False, 'fetchMarginMode': False, 'fetchMarginModes': False, 'fetchMarketLeverageTiers': False, 'fetchMarkets': True, 'fetchMarkOHLCV': False, 'fetchMarkPrices': False, 'fetchMyLiquidations': False, 'fetchMySettlementHistory': False, 'fetchMyTrades': True, 'fetchOHLCV': True, 'fetchOpenInterest': False, 'fetchOpenInterestHistory': False, 'fetchOpenInterests': False, 'fetchOpenOrders': True, 'fetchOption': False, 'fetchOptionChain': False, 'fetchOrder': True, 'fetchOrderBook': True, 'fetchOrders': True, 'fetchPosition': False, 'fetchPositionHistory': False, 'fetchPositionMode': False, 'fetchPositions': False, 'fetchPositionsForSymbol': False, 'fetchPositionsHistory': False, 'fetchPositionsRisk': False, 'fetchPremiumIndexOHLCV': False, 'fetchSettlementHistory': False, 'fetchTicker': True, 'fetchTickers': True, 'fetchTrades': True, 'fetchTradingFee': False, 'fetchTradingFees': False, 'fetchTransfer': False, 'fetchTransfers': False, 'fetchVolatilityHistory': False, 'fetchWithdrawal': False, 'fetchWithdrawals': True, 'reduceMargin': False, 'repayCrossMargin': False, 'repayIsolatedMargin': False, 'repayMargin': False, 'setLeverage': False, 'setMargin': False, 'setMarginMode': False, 'setPositionMode': False, 'transfer': False, 'withdraw': False, }, 'timeframes': { '5m': '5', '15m': '15', '30m': '30', '1h': '60', '4h': '240', '1d': 'D', }, 'urls': { 'logo': 'https://github.com/user-attachments/assets/dce49f3a-61e5-4ba0-a2fe-41d192fd0e5d', 'api': { 'rest': 'https://btc-alpha.com/api', }, 'www': 'https://btc-alpha.com', 'doc': 'https://btc-alpha.github.io/api-docs', 'fees': 'https://btc-alpha.com/fees/', 'referral': 'https://btc-alpha.com/?r=123788', }, 'api': { 'public': { 'get': [ 'currencies/', 'pairs/', 'orderbook/{pair_name}', 'exchanges/', 'charts/{pair}/{type}/chart/', 'ticker/', ], }, 'private': { 'get': [ 'wallets/', 'orders/own/', 'order/{id}/', 'exchanges/own/', 'deposits/', 'withdraws/', ], 'post': [ 'order/', 'order-cancel/', ], }, }, 'fees': { 'trading': { 'maker': self.parse_number('0.002'), 'taker': self.parse_number('0.002'), }, 'funding': { 'withdraw': {}, }, }, 'commonCurrencies': { 'CBC': 'Cashbery', }, 'features': { 'spot': { 'sandbox': False, 'createOrder': { 'marginMode': False, 'triggerPrice': False, 'triggerPriceType': None, 'triggerDirection': False, 'stopLossPrice': False, 'takeProfitPrice': False, 'attachedStopLossTakeProfit': None, 'timeInForce': { 'IOC': False, 'FOK': False, 'PO': False, 'GTD': False, }, 'hedged': False, 'leverage': False, 'marketBuyRequiresPrice': False, 'marketBuyByCost': False, 'selfTradePrevention': False, 'trailing': False, 'iceberg': False, }, 'createOrders': None, 'fetchMyTrades': { 'marginMode': False, 'limit': 100, 'daysBack': None, 'untilDays': None, 'symbolRequired': False, }, 'fetchOrder': { 'marginMode': False, 'trigger': False, 'trailing': False, 'symbolRequired': False, }, 'fetchOpenOrders': { 'marginMode': False, 'limit': 2000, 'trigger': False, 'trailing': False, 'symbolRequired': False, }, 'fetchOrders': { 'marginMode': False, 'limit': 2000, 'daysBack': None, 'untilDays': None, 'trigger': False, 'trailing': False, 'symbolRequired': False, }, 'fetchClosedOrders': { 'marginMode': False, 'limit': 2000, 'daysBack': None, 'daysBackCanceled': None, 'untilDays': None, 'trigger': False, 'trailing': False, 'symbolRequired': False, }, 'fetchOHLCV': { 'limit': 720, }, }, 'swap': { 'linear': None, 'inverse': None, }, 'future': { 'linear': None, 'inverse': None, }, }, 'precisionMode': TICK_SIZE, 'exceptions': { 'exact': {}, 'broad': { 'Out of balance': InsufficientFunds, # {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"} }, }, }) async def fetch_markets(self, params={}) -> List[Market]: """ retrieves data on all markets for btcalpha https://btc-alpha.github.io/api-docs/#list-all-currencies :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict[]: an array of objects representing market data """ response = await self.publicGetPairs(params) # # [ # { # "name": "1INCH_USDT", # "currency1": "1INCH", # "currency2": "USDT", # "price_precision": 4, # "amount_precision": 2, # "minimum_order_size": "0.01000000", # "maximum_order_size": "900000.00000000", # "minimum_order_value": "10.00000000", # "liquidity_type": 10 # }, # ] # return self.parse_markets(response) def parse_market(self, market: dict) -> Market: id = self.safe_string(market, 'name') baseId = self.safe_string(market, 'currency1') quoteId = self.safe_string(market, 'currency2') base = self.safe_currency_code(baseId) quote = self.safe_currency_code(quoteId) pricePrecision = self.safe_string(market, 'price_precision') priceLimit = self.parse_precision(pricePrecision) amountLimit = self.safe_string(market, 'minimum_order_size') return { 'id': id, 'symbol': base + '/' + quote, 'base': base, 'quote': quote, 'settle': None, 'baseId': baseId, 'quoteId': quoteId, 'settleId': None, 'type': 'spot', 'spot': True, 'margin': False, 'swap': False, 'future': False, 'option': False, 'active': True, 'contract': False, 'linear': None, 'inverse': None, 'contractSize': None, 'expiry': None, 'expiryDatetime': None, 'strike': None, 'optionType': None, 'precision': { 'amount': self.parse_number(self.parse_precision(self.safe_string(market, 'amount_precision'))), 'price': self.parse_number(self.parse_precision((pricePrecision))), }, 'limits': { 'leverage': { 'min': None, 'max': None, }, 'amount': { 'min': self.parse_number(amountLimit), 'max': self.safe_number(market, 'maximum_order_size'), }, 'price': { 'min': self.parse_number(priceLimit), 'max': None, }, 'cost': { 'min': self.parse_number(Precise.string_mul(priceLimit, amountLimit)), 'max': None, }, }, 'created': None, 'info': market, } async def fetch_tickers(self, symbols: Strings = None, params={}) -> Tickers: """ https://btc-alpha.github.io/api-docs/#tickers fetches price tickers for multiple markets, statistical information calculated over the past 24 hours for each market :param str[]|None symbols: unified symbols of the markets to fetch the ticker for, all market tickers are returned if not assigned :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: a dictionary of `ticker structures ` """ await self.load_markets() response = await self.publicGetTicker(params) # # [ # { # "timestamp": "1674658.445272", # "pair": "BTC_USDT", # "last": "22476.85", # "diff": "458.96", # "vol": "6660.847784", # "high": "23106.08", # "low": "22348.29", # "buy": "22508.46", # "sell": "22521.11" # }, # ... # ] # return self.parse_tickers(response, symbols) async def fetch_ticker(self, symbol: str, params={}) -> Ticker: """ https://btc-alpha.github.io/api-docs/#tickers fetches a price ticker, a statistical calculation with the information calculated over the past 24 hours for a specific market :param str symbol: unified symbol of the market to fetch the ticker for :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: a `ticker structure ` """ await self.load_markets() market = self.market(symbol) request: dict = { 'pair': market['id'], } response = await self.publicGetTicker(self.extend(request, params)) # # { # "timestamp": "1674658.445272", # "pair": "BTC_USDT", # "last": "22476.85", # "diff": "458.96", # "vol": "6660.847784", # "high": "23106.08", # "low": "22348.29", # "buy": "22508.46", # "sell": "22521.11" # } # return self.parse_ticker(response, market) def parse_ticker(self, ticker: dict, market: Market = None) -> Ticker: # # { # "timestamp": "1674658.445272", # "pair": "BTC_USDT", # "last": "22476.85", # "diff": "458.96", # "vol": "6660.847784", # "high": "23106.08", # "low": "22348.29", # "buy": "22508.46", # "sell": "22521.11" # } # timestampStr = self.safe_string(ticker, 'timestamp') timestamp = int(Precise.string_mul(timestampStr, '1000000')) marketId = self.safe_string(ticker, 'pair') market = self.safe_market(marketId, market, '_') last = self.safe_string(ticker, 'last') return self.safe_ticker({ 'info': ticker, 'symbol': market['symbol'], 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'high': self.safe_string(ticker, 'high'), 'low': self.safe_string(ticker, 'low'), 'bid': self.safe_string(ticker, 'buy'), 'bidVolume': None, 'ask': self.safe_string(ticker, 'sell'), 'askVolume': None, 'vwap': None, 'open': None, 'close': last, 'last': last, 'previousClose': None, 'change': self.safe_string(ticker, 'diff'), 'percentage': None, 'average': None, 'baseVolume': None, 'quoteVolume': self.safe_string(ticker, 'vol'), }, market) async def fetch_order_book(self, symbol: str, limit: Int = None, params={}) -> OrderBook: """ https://btc-alpha.github.io/api-docs/#get-orderbook fetches information on open orders with bid(buy) and ask(sell) prices, volumes and other data :param str symbol: unified symbol of the market to fetch the order book for :param int [limit]: the maximum amount of order book entries to return :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: A dictionary of `order book structures ` indexed by market symbols """ await self.load_markets() market = self.market(symbol) request: dict = { 'pair_name': market['id'], } if limit: request['limit_sell'] = limit request['limit_buy'] = limit response = await self.publicGetOrderbookPairName(self.extend(request, params)) return self.parse_order_book(response, market['symbol'], None, 'buy', 'sell', 'price', 'amount') def parse_bids_asks(self, bidasks, priceKey: IndexType = 0, amountKey: IndexType = 1, countOrIdKey: IndexType = 2): result = [] for i in range(0, len(bidasks)): bidask = bidasks[i] if bidask: result.append(self.parse_bid_ask(bidask, priceKey, amountKey)) return result def parse_trade(self, trade: dict, market: Market = None) -> Trade: # # fetchTrades(public) # # { # "id": "202203440", # "timestamp": "1637856276.264215", # "pair": "AAVE_USDT", # "price": "320.79900000", # "amount": "0.05000000", # "type": "buy" # } # # fetchMyTrades(private) # # { # "id": "202203440", # "timestamp": "1637856276.264215", # "pair": "AAVE_USDT", # "price": "320.79900000", # "amount": "0.05000000", # "type": "buy", # "my_side": "buy" # } # marketId = self.safe_string(trade, 'pair') market = self.safe_market(marketId, market, '_') timestampRaw = self.safe_string(trade, 'timestamp') timestamp = self.parse_to_int(Precise.string_mul(timestampRaw, '1000000')) priceString = self.safe_string(trade, 'price') amountString = self.safe_string(trade, 'amount') id = self.safe_string(trade, 'id') side = self.safe_string_2(trade, 'my_side', 'type') return self.safe_trade({ 'id': id, 'info': trade, 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'symbol': market['symbol'], 'order': id, 'type': 'limit', 'side': side, 'takerOrMaker': None, 'price': priceString, 'amount': amountString, 'cost': None, 'fee': None, }, market) async def fetch_trades(self, symbol: str, since: Int = None, limit: Int = None, params={}) -> List[Trade]: """ get the list of most recent trades for a particular symbol https://btc-alpha.github.io/api-docs/#list-all-exchanges :param str symbol: unified symbol of the market to fetch trades for :param int [since]: timestamp in ms of the earliest trade to fetch :param int [limit]: the maximum amount of trades to fetch :param dict [params]: extra parameters specific to the exchange API endpoint :returns Trade[]: a list of `trade structures ` """ await self.load_markets() market = None request: dict = {} if symbol is not None: market = self.market(symbol) request['pair'] = market['id'] if limit is not None: request['limit'] = limit trades = await self.publicGetExchanges(self.extend(request, params)) return self.parse_trades(trades, market, since, limit) async def fetch_deposits(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]: """ fetch all deposits made to an account https://btc-alpha.github.io/api-docs/#list-own-deposits :param str code: unified currency code :param int [since]: the earliest time in ms to fetch deposits for :param int [limit]: the maximum number of deposits structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict[]: a list of `transaction structures ` """ await self.load_markets() currency = None if code is not None: currency = self.currency(code) response = await self.privateGetDeposits(params) # # [ # { # "timestamp": 1485363039.18359, # "id": 317, # "currency": "BTC", # "amount": 530.00000000 # } # ] # return self.parse_transactions(response, currency, since, limit, {'type': 'deposit'}) async def fetch_withdrawals(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]: """ fetch all withdrawals made from an account https://btc-alpha.github.io/api-docs/#list-own-made-withdraws :param str code: unified currency code :param int [since]: the earliest time in ms to fetch withdrawals for :param int [limit]: the maximum number of withdrawals structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict[]: a list of `transaction structures ` """ await self.load_markets() currency = None request: dict = {} if code is not None: currency = self.currency(code) request['currency_id'] = currency['id'] response = await self.privateGetWithdraws(self.extend(request, params)) # # [ # { # "id": 403, # "timestamp": 1485363466.868539, # "currency": "BTC", # "amount": 0.53000000, # "status": 20 # } # ] # return self.parse_transactions(response, currency, since, limit, {'type': 'withdrawal'}) def parse_transaction(self, transaction: dict, currency: Currency = None) -> Transaction: # # deposit # { # "timestamp": 1485363039.18359, # "id": 317, # "currency": "BTC", # "amount": 530.00000000 # } # # withdrawal # { # "id": 403, # "timestamp": 1485363466.868539, # "currency": "BTC", # "amount": 0.53000000, # "status": 20 # } # timestamp = self.safe_timestamp(transaction, 'timestamp') currencyId = self.safe_string(transaction, 'currency') statusId = self.safe_string(transaction, 'status') return { 'id': self.safe_string(transaction, 'id'), 'info': transaction, 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'network': None, 'address': None, 'addressTo': None, 'addressFrom': None, 'tag': None, 'tagTo': None, 'tagFrom': None, 'currency': self.safe_currency_code(currencyId, currency), 'amount': self.safe_number(transaction, 'amount'), 'txid': None, 'type': None, 'status': self.parse_transaction_status(statusId), 'comment': None, 'internal': None, 'fee': None, 'updated': None, } def parse_transaction_status(self, status: Str): statuses: dict = { '10': 'pending', # New '20': 'pending', # Verified, waiting for approving '30': 'ok', # Approved by moderator '40': 'failed', # Refused by moderator. See your email for more details '50': 'canceled', # Cancelled by user } return self.safe_string(statuses, status, status) def parse_ohlcv(self, ohlcv, market: Market = None) -> list: # # { # "time":1591296000, # "open":0.024746, # "close":0.024728, # "low":0.024728, # "high":0.024753, # "volume":16.624 # } # return [ self.safe_timestamp(ohlcv, 'time'), self.safe_number(ohlcv, 'open'), self.safe_number(ohlcv, 'high'), self.safe_number(ohlcv, 'low'), self.safe_number(ohlcv, 'close'), self.safe_number(ohlcv, 'volume'), ] async def fetch_ohlcv(self, symbol: str, timeframe: str = '5m', since: Int = None, limit: Int = None, params={}) -> List[list]: """ fetches historical candlestick data containing the open, high, low, and close price, and the volume of a market https://btc-alpha.github.io/api-docs/#charts :param str symbol: unified symbol of the market to fetch OHLCV data for :param str timeframe: the length of time each candle represents :param int [since]: timestamp in ms of the earliest candle to fetch :param int [limit]: the maximum amount of candles to fetch :param dict [params]: extra parameters specific to the exchange API endpoint :returns int[][]: A list of candles ordered, open, high, low, close, volume """ await self.load_markets() market = self.market(symbol) request: dict = { 'pair': market['id'], 'type': self.safe_string(self.timeframes, timeframe, timeframe), } if limit is not None: request['limit'] = limit if since is not None: request['since'] = self.parse_to_int(since / 1000) response = await self.publicGetChartsPairTypeChart(self.extend(request, params)) # # [ # {"time":1591296000,"open":0.024746,"close":0.024728,"low":0.024728,"high":0.024753,"volume":16.624}, # {"time":1591295700,"open":0.024718,"close":0.02475,"low":0.024711,"high":0.02475,"volume":31.645}, # {"time":1591295400,"open":0.024721,"close":0.024717,"low":0.024711,"high":0.02473,"volume":65.071} # ] # return self.parse_ohlcvs(response, market, timeframe, since, limit) def parse_balance(self, response) -> Balances: result: dict = {'info': response} for i in range(0, len(response)): balance = response[i] currencyId = self.safe_string(balance, 'currency') code = self.safe_currency_code(currencyId) account = self.account() account['used'] = self.safe_string(balance, 'reserve') account['total'] = self.safe_string(balance, 'balance') result[code] = account return self.safe_balance(result) async def fetch_balance(self, params={}) -> Balances: """ query for balance and get the amount of funds available for trading or funds locked in orders https://btc-alpha.github.io/api-docs/#list-own-wallets :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: a `balance structure ` """ await self.load_markets() response = await self.privateGetWallets(params) return self.parse_balance(response) def parse_order_status(self, status: Str): statuses: dict = { '1': 'open', '2': 'canceled', '3': 'closed', } return self.safe_string(statuses, status, status) def parse_order(self, order: dict, market: Market = None) -> Order: # # fetchClosedOrders / fetchOrder # { # "id": "923763073", # "date": "1635451090368", # "type": "sell", # "pair": "XRP_USDT", # "price": "1.00000000", # "amount": "0.00000000", # "status": "3", # "amount_filled": "10.00000000", # "amount_original": "10.0" # "trades": [], # } # # createOrder # { # "success": True, # "date": "1635451754.497541", # "type": "sell", # "oid": "923776755", # "price": "1.0", # "amount": "10.0", # "amount_filled": "0.0", # "amount_original": "10.0", # "trades": [] # } # marketId = self.safe_string(order, 'pair') market = self.safe_market(marketId, market, '_') symbol = market['symbol'] success = self.safe_bool(order, 'success', False) timestamp = None if success: timestamp = self.safe_timestamp(order, 'date') else: timestamp = self.safe_integer(order, 'date') price = self.safe_string(order, 'price') remaining = self.safe_string(order, 'amount') filled = self.safe_string(order, 'amount_filled') amount = self.safe_string(order, 'amount_original') status = self.parse_order_status(self.safe_string(order, 'status')) id = self.safe_string_n(order, ['oid', 'id', 'order']) trades = self.safe_value(order, 'trades') side = self.safe_string_2(order, 'my_side', 'type') return self.safe_order({ 'id': id, 'clientOrderId': None, 'datetime': self.iso8601(timestamp), 'timestamp': timestamp, 'status': status, 'symbol': symbol, 'type': 'limit', 'timeInForce': None, 'postOnly': None, 'side': side, 'price': price, 'triggerPrice': None, 'cost': None, 'amount': amount, 'filled': filled, 'remaining': remaining, 'trades': trades, 'fee': None, 'info': order, 'lastTradeTimestamp': None, 'average': None, }, market) async def create_order(self, symbol: str, type: OrderType, side: OrderSide, amount: float, price: Num = None, params={}): """ https://btc-alpha.github.io/api-docs/#create-order create a trade order :param str symbol: unified symbol of the market to create an order in :param str type: 'limit' :param str side: 'buy' or 'sell' :param float amount: how much of currency you want to trade in units of base currency :param float [price]: the price at which the order is to be fulfilled, in units of the quote currency, ignored in market orders :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: an `order structure ` """ if type == 'market': raise InvalidOrder(self.id + ' only limits orders are supported') await self.load_markets() market = self.market(symbol) request: dict = { 'pair': market['id'], 'type': side, 'amount': amount, 'price': self.price_to_precision(symbol, price), } response = await self.privatePostOrder(self.extend(request, params)) if not response['success']: raise InvalidOrder(self.id + ' ' + self.json(response)) order = self.parse_order(response, market) orderAmount = str(order['amount']) amount = order['amount'] if Precise.string_gt(orderAmount, '0') else amount order['amount'] = self.parse_number(amount) return order async def cancel_order(self, id: str, symbol: Str = None, params={}): """ https://btc-alpha.github.io/api-docs/#cancel-order cancels an open order :param str id: order id :param str symbol: unified symbol of the market the order was made in :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: An `order structure ` """ request: dict = { 'order': id, } response = await self.privatePostOrderCancel(self.extend(request, params)) # # { # "order": 63568 # } # return self.parse_order(response) async def fetch_order(self, id: str, symbol: Str = None, params={}): """ https://btc-alpha.github.io/api-docs/#retrieve-single-order fetches information on an order made by the user :param str id: the order id :param str symbol: not used by btcalpha fetchOrder :param dict [params]: extra parameters specific to the exchange API endpoint :returns dict: An `order structure ` """ await self.load_markets() request: dict = { 'id': id, } order = await self.privateGetOrderId(self.extend(request, params)) return self.parse_order(order) async def fetch_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]: """ https://btc-alpha.github.io/api-docs/#list-own-orders fetches information on multiple orders made by the user :param str symbol: unified market symbol of the market orders were made in :param int [since]: the earliest time in ms to fetch orders for :param int [limit]: the maximum number of order structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns Order[]: a list of `order structures ` """ await self.load_markets() request: dict = {} market = None if symbol is not None: market = self.market(symbol) request['pair'] = market['id'] if limit is not None: request['limit'] = limit orders = await self.privateGetOrdersOwn(self.extend(request, params)) return self.parse_orders(orders, market, since, limit) async def fetch_open_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]: """ fetch all unfilled currently open orders https://btc-alpha.github.io/api-docs/#list-own-orders :param str symbol: unified market symbol :param int [since]: the earliest time in ms to fetch open orders for :param int [limit]: the maximum number of open orders structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns Order[]: a list of `order structures ` """ request: dict = { 'status': '1', } return await self.fetch_orders(symbol, since, limit, self.extend(request, params)) async def fetch_closed_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]: """ fetches information on multiple closed orders made by the user https://btc-alpha.github.io/api-docs/#list-own-orders :param str symbol: unified market symbol of the market orders were made in :param int [since]: the earliest time in ms to fetch orders for :param int [limit]: the maximum number of order structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns Order[]: a list of `order structures ` """ request: dict = { 'status': '3', } return await self.fetch_orders(symbol, since, limit, self.extend(request, params)) async def fetch_my_trades(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}): """ fetch all trades made by the user https://btc-alpha.github.io/api-docs/#list-own-exchanges :param str symbol: unified market symbol :param int [since]: the earliest time in ms to fetch trades for :param int [limit]: the maximum number of trades structures to retrieve :param dict [params]: extra parameters specific to the exchange API endpoint :returns Trade[]: a list of `trade structures ` """ await self.load_markets() request: dict = {} if symbol is not None: market = self.market(symbol) request['pair'] = market['id'] if limit is not None: request['limit'] = limit trades = await self.privateGetExchangesOwn(self.extend(request, params)) return self.parse_trades(trades, None, since, limit) def nonce(self): return self.milliseconds() def sign(self, path, api='public', method='GET', params={}, headers=None, body=None): query = self.urlencode(self.keysort(self.omit(params, self.extract_params(path)))) url = self.urls['api']['rest'] + '/' if path != 'charts/{pair}/{type}/chart/': url += 'v1/' url += self.implode_params(path, params) headers = {'Accept': 'application/json'} if api == 'public': if len(query): url += '?' + query else: self.check_required_credentials() payload = self.apiKey if method == 'POST': headers['Content-Type'] = 'application/x-www-form-urlencoded' body = query payload += body elif len(query): url += '?' + query headers['X-KEY'] = self.apiKey headers['X-SIGN'] = self.hmac(self.encode(payload), self.encode(self.secret), hashlib.sha256) headers['X-NONCE'] = str(self.nonce()) return {'url': url, 'method': method, 'body': body, 'headers': headers} def handle_errors(self, code: int, reason: str, url: str, method: str, headers: dict, body: str, response, requestHeaders, requestBody): if response is None: return None # fallback to default error handler # # {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"} # error = self.safe_string(response, 'error') if error is not None: feedback = self.id + ' ' + body self.throw_exactly_matched_exception(self.exceptions['exact'], error, feedback) self.throw_broadly_matched_exception(self.exceptions['broad'], error, feedback) raise ExchangeError(feedback) # unknown error return None