1031 lines
40 KiB
Python
1031 lines
40 KiB
Python
# -*- coding: utf-8 -*-
|
|
|
|
# PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN:
|
|
# https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code
|
|
|
|
from ccxt.base.exchange import Exchange
|
|
from ccxt.abstract.btcalpha import ImplicitAPI
|
|
import hashlib
|
|
from ccxt.base.types import Any, Balances, Currency, IndexType, Int, Market, Num, Order, OrderBook, OrderSide, OrderType, Str, Strings, Ticker, Tickers, Trade, Transaction
|
|
from typing import List
|
|
from ccxt.base.errors import ExchangeError
|
|
from ccxt.base.errors import InsufficientFunds
|
|
from ccxt.base.errors import InvalidOrder
|
|
from ccxt.base.decimal_to_precision import TICK_SIZE
|
|
from ccxt.base.precise import Precise
|
|
|
|
|
|
class btcalpha(Exchange, ImplicitAPI):
|
|
|
|
def describe(self) -> Any:
|
|
return self.deep_extend(super(btcalpha, self).describe(), {
|
|
'id': 'btcalpha',
|
|
'name': 'BTC-Alpha',
|
|
'countries': ['US'],
|
|
'version': 'v1',
|
|
'has': {
|
|
'CORS': None,
|
|
'spot': True,
|
|
'margin': False,
|
|
'swap': False,
|
|
'future': False,
|
|
'option': False,
|
|
'addMargin': False,
|
|
'borrowCrossMargin': False,
|
|
'borrowIsolatedMargin': False,
|
|
'borrowMargin': False,
|
|
'cancelOrder': True,
|
|
'closeAllPositions': False,
|
|
'closePosition': False,
|
|
'createDepositAddress': False,
|
|
'createOrder': True,
|
|
'createOrderWithTakeProfitAndStopLoss': False,
|
|
'createOrderWithTakeProfitAndStopLossWs': False,
|
|
'createPostOnlyOrder': False,
|
|
'createReduceOnlyOrder': False,
|
|
'createStopLimitOrder': False,
|
|
'createStopMarketOrder': False,
|
|
'createStopOrder': False,
|
|
'fetchBalance': True,
|
|
'fetchBorrowInterest': False,
|
|
'fetchBorrowRate': False,
|
|
'fetchBorrowRateHistories': False,
|
|
'fetchBorrowRateHistory': False,
|
|
'fetchBorrowRates': False,
|
|
'fetchBorrowRatesPerSymbol': False,
|
|
'fetchClosedOrders': True,
|
|
'fetchCrossBorrowRate': False,
|
|
'fetchCrossBorrowRates': False,
|
|
'fetchCurrencies': False,
|
|
'fetchDeposit': False,
|
|
'fetchDepositAddress': False,
|
|
'fetchDepositAddresses': False,
|
|
'fetchDepositAddressesByNetwork': False,
|
|
'fetchDeposits': True,
|
|
'fetchFundingHistory': False,
|
|
'fetchFundingInterval': False,
|
|
'fetchFundingIntervals': False,
|
|
'fetchFundingRate': False,
|
|
'fetchFundingRateHistory': False,
|
|
'fetchFundingRates': False,
|
|
'fetchGreeks': False,
|
|
'fetchIndexOHLCV': False,
|
|
'fetchIsolatedBorrowRate': False,
|
|
'fetchIsolatedBorrowRates': False,
|
|
'fetchIsolatedPositions': False,
|
|
'fetchL2OrderBook': True,
|
|
'fetchLeverage': False,
|
|
'fetchLeverages': False,
|
|
'fetchLeverageTiers': False,
|
|
'fetchLiquidations': False,
|
|
'fetchLongShortRatio': False,
|
|
'fetchLongShortRatioHistory': False,
|
|
'fetchMarginAdjustmentHistory': False,
|
|
'fetchMarginMode': False,
|
|
'fetchMarginModes': False,
|
|
'fetchMarketLeverageTiers': False,
|
|
'fetchMarkets': True,
|
|
'fetchMarkOHLCV': False,
|
|
'fetchMarkPrices': False,
|
|
'fetchMyLiquidations': False,
|
|
'fetchMySettlementHistory': False,
|
|
'fetchMyTrades': True,
|
|
'fetchOHLCV': True,
|
|
'fetchOpenInterest': False,
|
|
'fetchOpenInterestHistory': False,
|
|
'fetchOpenInterests': False,
|
|
'fetchOpenOrders': True,
|
|
'fetchOption': False,
|
|
'fetchOptionChain': False,
|
|
'fetchOrder': True,
|
|
'fetchOrderBook': True,
|
|
'fetchOrders': True,
|
|
'fetchPosition': False,
|
|
'fetchPositionHistory': False,
|
|
'fetchPositionMode': False,
|
|
'fetchPositions': False,
|
|
'fetchPositionsForSymbol': False,
|
|
'fetchPositionsHistory': False,
|
|
'fetchPositionsRisk': False,
|
|
'fetchPremiumIndexOHLCV': False,
|
|
'fetchSettlementHistory': False,
|
|
'fetchTicker': True,
|
|
'fetchTickers': True,
|
|
'fetchTrades': True,
|
|
'fetchTradingFee': False,
|
|
'fetchTradingFees': False,
|
|
'fetchTransfer': False,
|
|
'fetchTransfers': False,
|
|
'fetchVolatilityHistory': False,
|
|
'fetchWithdrawal': False,
|
|
'fetchWithdrawals': True,
|
|
'reduceMargin': False,
|
|
'repayCrossMargin': False,
|
|
'repayIsolatedMargin': False,
|
|
'repayMargin': False,
|
|
'setLeverage': False,
|
|
'setMargin': False,
|
|
'setMarginMode': False,
|
|
'setPositionMode': False,
|
|
'transfer': False,
|
|
'withdraw': False,
|
|
},
|
|
'timeframes': {
|
|
'5m': '5',
|
|
'15m': '15',
|
|
'30m': '30',
|
|
'1h': '60',
|
|
'4h': '240',
|
|
'1d': 'D',
|
|
},
|
|
'urls': {
|
|
'logo': 'https://github.com/user-attachments/assets/dce49f3a-61e5-4ba0-a2fe-41d192fd0e5d',
|
|
'api': {
|
|
'rest': 'https://btc-alpha.com/api',
|
|
},
|
|
'www': 'https://btc-alpha.com',
|
|
'doc': 'https://btc-alpha.github.io/api-docs',
|
|
'fees': 'https://btc-alpha.com/fees/',
|
|
'referral': 'https://btc-alpha.com/?r=123788',
|
|
},
|
|
'api': {
|
|
'public': {
|
|
'get': [
|
|
'currencies/',
|
|
'pairs/',
|
|
'orderbook/{pair_name}',
|
|
'exchanges/',
|
|
'charts/{pair}/{type}/chart/',
|
|
'ticker/',
|
|
],
|
|
},
|
|
'private': {
|
|
'get': [
|
|
'wallets/',
|
|
'orders/own/',
|
|
'order/{id}/',
|
|
'exchanges/own/',
|
|
'deposits/',
|
|
'withdraws/',
|
|
],
|
|
'post': [
|
|
'order/',
|
|
'order-cancel/',
|
|
],
|
|
},
|
|
},
|
|
'fees': {
|
|
'trading': {
|
|
'maker': self.parse_number('0.002'),
|
|
'taker': self.parse_number('0.002'),
|
|
},
|
|
'funding': {
|
|
'withdraw': {},
|
|
},
|
|
},
|
|
'commonCurrencies': {
|
|
'CBC': 'Cashbery',
|
|
},
|
|
'features': {
|
|
'spot': {
|
|
'sandbox': False,
|
|
'createOrder': {
|
|
'marginMode': False,
|
|
'triggerPrice': False,
|
|
'triggerPriceType': None,
|
|
'triggerDirection': False,
|
|
'stopLossPrice': False,
|
|
'takeProfitPrice': False,
|
|
'attachedStopLossTakeProfit': None,
|
|
'timeInForce': {
|
|
'IOC': False,
|
|
'FOK': False,
|
|
'PO': False,
|
|
'GTD': False,
|
|
},
|
|
'hedged': False,
|
|
'leverage': False,
|
|
'marketBuyRequiresPrice': False,
|
|
'marketBuyByCost': False,
|
|
'selfTradePrevention': False,
|
|
'trailing': False,
|
|
'iceberg': False,
|
|
},
|
|
'createOrders': None,
|
|
'fetchMyTrades': {
|
|
'marginMode': False,
|
|
'limit': 100,
|
|
'daysBack': None,
|
|
'untilDays': None,
|
|
'symbolRequired': False,
|
|
},
|
|
'fetchOrder': {
|
|
'marginMode': False,
|
|
'trigger': False,
|
|
'trailing': False,
|
|
'symbolRequired': False,
|
|
},
|
|
'fetchOpenOrders': {
|
|
'marginMode': False,
|
|
'limit': 2000,
|
|
'trigger': False,
|
|
'trailing': False,
|
|
'symbolRequired': False,
|
|
},
|
|
'fetchOrders': {
|
|
'marginMode': False,
|
|
'limit': 2000,
|
|
'daysBack': None,
|
|
'untilDays': None,
|
|
'trigger': False,
|
|
'trailing': False,
|
|
'symbolRequired': False,
|
|
},
|
|
'fetchClosedOrders': {
|
|
'marginMode': False,
|
|
'limit': 2000,
|
|
'daysBack': None,
|
|
'daysBackCanceled': None,
|
|
'untilDays': None,
|
|
'trigger': False,
|
|
'trailing': False,
|
|
'symbolRequired': False,
|
|
},
|
|
'fetchOHLCV': {
|
|
'limit': 720,
|
|
},
|
|
},
|
|
'swap': {
|
|
'linear': None,
|
|
'inverse': None,
|
|
},
|
|
'future': {
|
|
'linear': None,
|
|
'inverse': None,
|
|
},
|
|
},
|
|
'precisionMode': TICK_SIZE,
|
|
'exceptions': {
|
|
'exact': {},
|
|
'broad': {
|
|
'Out of balance': InsufficientFunds, # {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"}
|
|
},
|
|
},
|
|
})
|
|
|
|
def fetch_markets(self, params={}) -> List[Market]:
|
|
"""
|
|
retrieves data on all markets for btcalpha
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-all-currencies
|
|
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict[]: an array of objects representing market data
|
|
"""
|
|
response = self.publicGetPairs(params)
|
|
#
|
|
# [
|
|
# {
|
|
# "name": "1INCH_USDT",
|
|
# "currency1": "1INCH",
|
|
# "currency2": "USDT",
|
|
# "price_precision": 4,
|
|
# "amount_precision": 2,
|
|
# "minimum_order_size": "0.01000000",
|
|
# "maximum_order_size": "900000.00000000",
|
|
# "minimum_order_value": "10.00000000",
|
|
# "liquidity_type": 10
|
|
# },
|
|
# ]
|
|
#
|
|
return self.parse_markets(response)
|
|
|
|
def parse_market(self, market: dict) -> Market:
|
|
id = self.safe_string(market, 'name')
|
|
baseId = self.safe_string(market, 'currency1')
|
|
quoteId = self.safe_string(market, 'currency2')
|
|
base = self.safe_currency_code(baseId)
|
|
quote = self.safe_currency_code(quoteId)
|
|
pricePrecision = self.safe_string(market, 'price_precision')
|
|
priceLimit = self.parse_precision(pricePrecision)
|
|
amountLimit = self.safe_string(market, 'minimum_order_size')
|
|
return {
|
|
'id': id,
|
|
'symbol': base + '/' + quote,
|
|
'base': base,
|
|
'quote': quote,
|
|
'settle': None,
|
|
'baseId': baseId,
|
|
'quoteId': quoteId,
|
|
'settleId': None,
|
|
'type': 'spot',
|
|
'spot': True,
|
|
'margin': False,
|
|
'swap': False,
|
|
'future': False,
|
|
'option': False,
|
|
'active': True,
|
|
'contract': False,
|
|
'linear': None,
|
|
'inverse': None,
|
|
'contractSize': None,
|
|
'expiry': None,
|
|
'expiryDatetime': None,
|
|
'strike': None,
|
|
'optionType': None,
|
|
'precision': {
|
|
'amount': self.parse_number(self.parse_precision(self.safe_string(market, 'amount_precision'))),
|
|
'price': self.parse_number(self.parse_precision((pricePrecision))),
|
|
},
|
|
'limits': {
|
|
'leverage': {
|
|
'min': None,
|
|
'max': None,
|
|
},
|
|
'amount': {
|
|
'min': self.parse_number(amountLimit),
|
|
'max': self.safe_number(market, 'maximum_order_size'),
|
|
},
|
|
'price': {
|
|
'min': self.parse_number(priceLimit),
|
|
'max': None,
|
|
},
|
|
'cost': {
|
|
'min': self.parse_number(Precise.string_mul(priceLimit, amountLimit)),
|
|
'max': None,
|
|
},
|
|
},
|
|
'created': None,
|
|
'info': market,
|
|
}
|
|
|
|
def fetch_tickers(self, symbols: Strings = None, params={}) -> Tickers:
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#tickers
|
|
|
|
fetches price tickers for multiple markets, statistical information calculated over the past 24 hours for each market
|
|
:param str[]|None symbols: unified symbols of the markets to fetch the ticker for, all market tickers are returned if not assigned
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: a dictionary of `ticker structures <https://docs.ccxt.com/#/?id=ticker-structure>`
|
|
"""
|
|
self.load_markets()
|
|
response = self.publicGetTicker(params)
|
|
#
|
|
# [
|
|
# {
|
|
# "timestamp": "1674658.445272",
|
|
# "pair": "BTC_USDT",
|
|
# "last": "22476.85",
|
|
# "diff": "458.96",
|
|
# "vol": "6660.847784",
|
|
# "high": "23106.08",
|
|
# "low": "22348.29",
|
|
# "buy": "22508.46",
|
|
# "sell": "22521.11"
|
|
# },
|
|
# ...
|
|
# ]
|
|
#
|
|
return self.parse_tickers(response, symbols)
|
|
|
|
def fetch_ticker(self, symbol: str, params={}) -> Ticker:
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#tickers
|
|
|
|
fetches a price ticker, a statistical calculation with the information calculated over the past 24 hours for a specific market
|
|
:param str symbol: unified symbol of the market to fetch the ticker for
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: a `ticker structure <https://docs.ccxt.com/#/?id=ticker-structure>`
|
|
"""
|
|
self.load_markets()
|
|
market = self.market(symbol)
|
|
request: dict = {
|
|
'pair': market['id'],
|
|
}
|
|
response = self.publicGetTicker(self.extend(request, params))
|
|
#
|
|
# {
|
|
# "timestamp": "1674658.445272",
|
|
# "pair": "BTC_USDT",
|
|
# "last": "22476.85",
|
|
# "diff": "458.96",
|
|
# "vol": "6660.847784",
|
|
# "high": "23106.08",
|
|
# "low": "22348.29",
|
|
# "buy": "22508.46",
|
|
# "sell": "22521.11"
|
|
# }
|
|
#
|
|
return self.parse_ticker(response, market)
|
|
|
|
def parse_ticker(self, ticker: dict, market: Market = None) -> Ticker:
|
|
#
|
|
# {
|
|
# "timestamp": "1674658.445272",
|
|
# "pair": "BTC_USDT",
|
|
# "last": "22476.85",
|
|
# "diff": "458.96",
|
|
# "vol": "6660.847784",
|
|
# "high": "23106.08",
|
|
# "low": "22348.29",
|
|
# "buy": "22508.46",
|
|
# "sell": "22521.11"
|
|
# }
|
|
#
|
|
timestampStr = self.safe_string(ticker, 'timestamp')
|
|
timestamp = int(Precise.string_mul(timestampStr, '1000000'))
|
|
marketId = self.safe_string(ticker, 'pair')
|
|
market = self.safe_market(marketId, market, '_')
|
|
last = self.safe_string(ticker, 'last')
|
|
return self.safe_ticker({
|
|
'info': ticker,
|
|
'symbol': market['symbol'],
|
|
'timestamp': timestamp,
|
|
'datetime': self.iso8601(timestamp),
|
|
'high': self.safe_string(ticker, 'high'),
|
|
'low': self.safe_string(ticker, 'low'),
|
|
'bid': self.safe_string(ticker, 'buy'),
|
|
'bidVolume': None,
|
|
'ask': self.safe_string(ticker, 'sell'),
|
|
'askVolume': None,
|
|
'vwap': None,
|
|
'open': None,
|
|
'close': last,
|
|
'last': last,
|
|
'previousClose': None,
|
|
'change': self.safe_string(ticker, 'diff'),
|
|
'percentage': None,
|
|
'average': None,
|
|
'baseVolume': None,
|
|
'quoteVolume': self.safe_string(ticker, 'vol'),
|
|
}, market)
|
|
|
|
def fetch_order_book(self, symbol: str, limit: Int = None, params={}) -> OrderBook:
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#get-orderbook
|
|
|
|
fetches information on open orders with bid(buy) and ask(sell) prices, volumes and other data
|
|
:param str symbol: unified symbol of the market to fetch the order book for
|
|
:param int [limit]: the maximum amount of order book entries to return
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: A dictionary of `order book structures <https://docs.ccxt.com/#/?id=order-book-structure>` indexed by market symbols
|
|
"""
|
|
self.load_markets()
|
|
market = self.market(symbol)
|
|
request: dict = {
|
|
'pair_name': market['id'],
|
|
}
|
|
if limit:
|
|
request['limit_sell'] = limit
|
|
request['limit_buy'] = limit
|
|
response = self.publicGetOrderbookPairName(self.extend(request, params))
|
|
return self.parse_order_book(response, market['symbol'], None, 'buy', 'sell', 'price', 'amount')
|
|
|
|
def parse_bids_asks(self, bidasks, priceKey: IndexType = 0, amountKey: IndexType = 1, countOrIdKey: IndexType = 2):
|
|
result = []
|
|
for i in range(0, len(bidasks)):
|
|
bidask = bidasks[i]
|
|
if bidask:
|
|
result.append(self.parse_bid_ask(bidask, priceKey, amountKey))
|
|
return result
|
|
|
|
def parse_trade(self, trade: dict, market: Market = None) -> Trade:
|
|
#
|
|
# fetchTrades(public)
|
|
#
|
|
# {
|
|
# "id": "202203440",
|
|
# "timestamp": "1637856276.264215",
|
|
# "pair": "AAVE_USDT",
|
|
# "price": "320.79900000",
|
|
# "amount": "0.05000000",
|
|
# "type": "buy"
|
|
# }
|
|
#
|
|
# fetchMyTrades(private)
|
|
#
|
|
# {
|
|
# "id": "202203440",
|
|
# "timestamp": "1637856276.264215",
|
|
# "pair": "AAVE_USDT",
|
|
# "price": "320.79900000",
|
|
# "amount": "0.05000000",
|
|
# "type": "buy",
|
|
# "my_side": "buy"
|
|
# }
|
|
#
|
|
marketId = self.safe_string(trade, 'pair')
|
|
market = self.safe_market(marketId, market, '_')
|
|
timestampRaw = self.safe_string(trade, 'timestamp')
|
|
timestamp = self.parse_to_int(Precise.string_mul(timestampRaw, '1000000'))
|
|
priceString = self.safe_string(trade, 'price')
|
|
amountString = self.safe_string(trade, 'amount')
|
|
id = self.safe_string(trade, 'id')
|
|
side = self.safe_string_2(trade, 'my_side', 'type')
|
|
return self.safe_trade({
|
|
'id': id,
|
|
'info': trade,
|
|
'timestamp': timestamp,
|
|
'datetime': self.iso8601(timestamp),
|
|
'symbol': market['symbol'],
|
|
'order': id,
|
|
'type': 'limit',
|
|
'side': side,
|
|
'takerOrMaker': None,
|
|
'price': priceString,
|
|
'amount': amountString,
|
|
'cost': None,
|
|
'fee': None,
|
|
}, market)
|
|
|
|
def fetch_trades(self, symbol: str, since: Int = None, limit: Int = None, params={}) -> List[Trade]:
|
|
"""
|
|
get the list of most recent trades for a particular symbol
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-all-exchanges
|
|
|
|
:param str symbol: unified symbol of the market to fetch trades for
|
|
:param int [since]: timestamp in ms of the earliest trade to fetch
|
|
:param int [limit]: the maximum amount of trades to fetch
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns Trade[]: a list of `trade structures <https://docs.ccxt.com/#/?id=public-trades>`
|
|
"""
|
|
self.load_markets()
|
|
market = None
|
|
request: dict = {}
|
|
if symbol is not None:
|
|
market = self.market(symbol)
|
|
request['pair'] = market['id']
|
|
if limit is not None:
|
|
request['limit'] = limit
|
|
trades = self.publicGetExchanges(self.extend(request, params))
|
|
return self.parse_trades(trades, market, since, limit)
|
|
|
|
def fetch_deposits(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
|
|
"""
|
|
fetch all deposits made to an account
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-deposits
|
|
|
|
:param str code: unified currency code
|
|
:param int [since]: the earliest time in ms to fetch deposits for
|
|
:param int [limit]: the maximum number of deposits structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict[]: a list of `transaction structures <https://docs.ccxt.com/#/?id=transaction-structure>`
|
|
"""
|
|
self.load_markets()
|
|
currency = None
|
|
if code is not None:
|
|
currency = self.currency(code)
|
|
response = self.privateGetDeposits(params)
|
|
#
|
|
# [
|
|
# {
|
|
# "timestamp": 1485363039.18359,
|
|
# "id": 317,
|
|
# "currency": "BTC",
|
|
# "amount": 530.00000000
|
|
# }
|
|
# ]
|
|
#
|
|
return self.parse_transactions(response, currency, since, limit, {'type': 'deposit'})
|
|
|
|
def fetch_withdrawals(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
|
|
"""
|
|
fetch all withdrawals made from an account
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-made-withdraws
|
|
|
|
:param str code: unified currency code
|
|
:param int [since]: the earliest time in ms to fetch withdrawals for
|
|
:param int [limit]: the maximum number of withdrawals structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict[]: a list of `transaction structures <https://docs.ccxt.com/#/?id=transaction-structure>`
|
|
"""
|
|
self.load_markets()
|
|
currency = None
|
|
request: dict = {}
|
|
if code is not None:
|
|
currency = self.currency(code)
|
|
request['currency_id'] = currency['id']
|
|
response = self.privateGetWithdraws(self.extend(request, params))
|
|
#
|
|
# [
|
|
# {
|
|
# "id": 403,
|
|
# "timestamp": 1485363466.868539,
|
|
# "currency": "BTC",
|
|
# "amount": 0.53000000,
|
|
# "status": 20
|
|
# }
|
|
# ]
|
|
#
|
|
return self.parse_transactions(response, currency, since, limit, {'type': 'withdrawal'})
|
|
|
|
def parse_transaction(self, transaction: dict, currency: Currency = None) -> Transaction:
|
|
#
|
|
# deposit
|
|
# {
|
|
# "timestamp": 1485363039.18359,
|
|
# "id": 317,
|
|
# "currency": "BTC",
|
|
# "amount": 530.00000000
|
|
# }
|
|
#
|
|
# withdrawal
|
|
# {
|
|
# "id": 403,
|
|
# "timestamp": 1485363466.868539,
|
|
# "currency": "BTC",
|
|
# "amount": 0.53000000,
|
|
# "status": 20
|
|
# }
|
|
#
|
|
timestamp = self.safe_timestamp(transaction, 'timestamp')
|
|
currencyId = self.safe_string(transaction, 'currency')
|
|
statusId = self.safe_string(transaction, 'status')
|
|
return {
|
|
'id': self.safe_string(transaction, 'id'),
|
|
'info': transaction,
|
|
'timestamp': timestamp,
|
|
'datetime': self.iso8601(timestamp),
|
|
'network': None,
|
|
'address': None,
|
|
'addressTo': None,
|
|
'addressFrom': None,
|
|
'tag': None,
|
|
'tagTo': None,
|
|
'tagFrom': None,
|
|
'currency': self.safe_currency_code(currencyId, currency),
|
|
'amount': self.safe_number(transaction, 'amount'),
|
|
'txid': None,
|
|
'type': None,
|
|
'status': self.parse_transaction_status(statusId),
|
|
'comment': None,
|
|
'internal': None,
|
|
'fee': None,
|
|
'updated': None,
|
|
}
|
|
|
|
def parse_transaction_status(self, status: Str):
|
|
statuses: dict = {
|
|
'10': 'pending', # New
|
|
'20': 'pending', # Verified, waiting for approving
|
|
'30': 'ok', # Approved by moderator
|
|
'40': 'failed', # Refused by moderator. See your email for more details
|
|
'50': 'canceled', # Cancelled by user
|
|
}
|
|
return self.safe_string(statuses, status, status)
|
|
|
|
def parse_ohlcv(self, ohlcv, market: Market = None) -> list:
|
|
#
|
|
# {
|
|
# "time":1591296000,
|
|
# "open":0.024746,
|
|
# "close":0.024728,
|
|
# "low":0.024728,
|
|
# "high":0.024753,
|
|
# "volume":16.624
|
|
# }
|
|
#
|
|
return [
|
|
self.safe_timestamp(ohlcv, 'time'),
|
|
self.safe_number(ohlcv, 'open'),
|
|
self.safe_number(ohlcv, 'high'),
|
|
self.safe_number(ohlcv, 'low'),
|
|
self.safe_number(ohlcv, 'close'),
|
|
self.safe_number(ohlcv, 'volume'),
|
|
]
|
|
|
|
def fetch_ohlcv(self, symbol: str, timeframe: str = '5m', since: Int = None, limit: Int = None, params={}) -> List[list]:
|
|
"""
|
|
fetches historical candlestick data containing the open, high, low, and close price, and the volume of a market
|
|
|
|
https://btc-alpha.github.io/api-docs/#charts
|
|
|
|
:param str symbol: unified symbol of the market to fetch OHLCV data for
|
|
:param str timeframe: the length of time each candle represents
|
|
:param int [since]: timestamp in ms of the earliest candle to fetch
|
|
:param int [limit]: the maximum amount of candles to fetch
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns int[][]: A list of candles ordered, open, high, low, close, volume
|
|
"""
|
|
self.load_markets()
|
|
market = self.market(symbol)
|
|
request: dict = {
|
|
'pair': market['id'],
|
|
'type': self.safe_string(self.timeframes, timeframe, timeframe),
|
|
}
|
|
if limit is not None:
|
|
request['limit'] = limit
|
|
if since is not None:
|
|
request['since'] = self.parse_to_int(since / 1000)
|
|
response = self.publicGetChartsPairTypeChart(self.extend(request, params))
|
|
#
|
|
# [
|
|
# {"time":1591296000,"open":0.024746,"close":0.024728,"low":0.024728,"high":0.024753,"volume":16.624},
|
|
# {"time":1591295700,"open":0.024718,"close":0.02475,"low":0.024711,"high":0.02475,"volume":31.645},
|
|
# {"time":1591295400,"open":0.024721,"close":0.024717,"low":0.024711,"high":0.02473,"volume":65.071}
|
|
# ]
|
|
#
|
|
return self.parse_ohlcvs(response, market, timeframe, since, limit)
|
|
|
|
def parse_balance(self, response) -> Balances:
|
|
result: dict = {'info': response}
|
|
for i in range(0, len(response)):
|
|
balance = response[i]
|
|
currencyId = self.safe_string(balance, 'currency')
|
|
code = self.safe_currency_code(currencyId)
|
|
account = self.account()
|
|
account['used'] = self.safe_string(balance, 'reserve')
|
|
account['total'] = self.safe_string(balance, 'balance')
|
|
result[code] = account
|
|
return self.safe_balance(result)
|
|
|
|
def fetch_balance(self, params={}) -> Balances:
|
|
"""
|
|
query for balance and get the amount of funds available for trading or funds locked in orders
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-wallets
|
|
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: a `balance structure <https://docs.ccxt.com/#/?id=balance-structure>`
|
|
"""
|
|
self.load_markets()
|
|
response = self.privateGetWallets(params)
|
|
return self.parse_balance(response)
|
|
|
|
def parse_order_status(self, status: Str):
|
|
statuses: dict = {
|
|
'1': 'open',
|
|
'2': 'canceled',
|
|
'3': 'closed',
|
|
}
|
|
return self.safe_string(statuses, status, status)
|
|
|
|
def parse_order(self, order: dict, market: Market = None) -> Order:
|
|
#
|
|
# fetchClosedOrders / fetchOrder
|
|
# {
|
|
# "id": "923763073",
|
|
# "date": "1635451090368",
|
|
# "type": "sell",
|
|
# "pair": "XRP_USDT",
|
|
# "price": "1.00000000",
|
|
# "amount": "0.00000000",
|
|
# "status": "3",
|
|
# "amount_filled": "10.00000000",
|
|
# "amount_original": "10.0"
|
|
# "trades": [],
|
|
# }
|
|
#
|
|
# createOrder
|
|
# {
|
|
# "success": True,
|
|
# "date": "1635451754.497541",
|
|
# "type": "sell",
|
|
# "oid": "923776755",
|
|
# "price": "1.0",
|
|
# "amount": "10.0",
|
|
# "amount_filled": "0.0",
|
|
# "amount_original": "10.0",
|
|
# "trades": []
|
|
# }
|
|
#
|
|
marketId = self.safe_string(order, 'pair')
|
|
market = self.safe_market(marketId, market, '_')
|
|
symbol = market['symbol']
|
|
success = self.safe_bool(order, 'success', False)
|
|
timestamp = None
|
|
if success:
|
|
timestamp = self.safe_timestamp(order, 'date')
|
|
else:
|
|
timestamp = self.safe_integer(order, 'date')
|
|
price = self.safe_string(order, 'price')
|
|
remaining = self.safe_string(order, 'amount')
|
|
filled = self.safe_string(order, 'amount_filled')
|
|
amount = self.safe_string(order, 'amount_original')
|
|
status = self.parse_order_status(self.safe_string(order, 'status'))
|
|
id = self.safe_string_n(order, ['oid', 'id', 'order'])
|
|
trades = self.safe_value(order, 'trades')
|
|
side = self.safe_string_2(order, 'my_side', 'type')
|
|
return self.safe_order({
|
|
'id': id,
|
|
'clientOrderId': None,
|
|
'datetime': self.iso8601(timestamp),
|
|
'timestamp': timestamp,
|
|
'status': status,
|
|
'symbol': symbol,
|
|
'type': 'limit',
|
|
'timeInForce': None,
|
|
'postOnly': None,
|
|
'side': side,
|
|
'price': price,
|
|
'triggerPrice': None,
|
|
'cost': None,
|
|
'amount': amount,
|
|
'filled': filled,
|
|
'remaining': remaining,
|
|
'trades': trades,
|
|
'fee': None,
|
|
'info': order,
|
|
'lastTradeTimestamp': None,
|
|
'average': None,
|
|
}, market)
|
|
|
|
def create_order(self, symbol: str, type: OrderType, side: OrderSide, amount: float, price: Num = None, params={}):
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#create-order
|
|
|
|
create a trade order
|
|
:param str symbol: unified symbol of the market to create an order in
|
|
:param str type: 'limit'
|
|
:param str side: 'buy' or 'sell'
|
|
:param float amount: how much of currency you want to trade in units of base currency
|
|
:param float [price]: the price at which the order is to be fulfilled, in units of the quote currency, ignored in market orders
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: an `order structure <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
if type == 'market':
|
|
raise InvalidOrder(self.id + ' only limits orders are supported')
|
|
self.load_markets()
|
|
market = self.market(symbol)
|
|
request: dict = {
|
|
'pair': market['id'],
|
|
'type': side,
|
|
'amount': amount,
|
|
'price': self.price_to_precision(symbol, price),
|
|
}
|
|
response = self.privatePostOrder(self.extend(request, params))
|
|
if not response['success']:
|
|
raise InvalidOrder(self.id + ' ' + self.json(response))
|
|
order = self.parse_order(response, market)
|
|
orderAmount = str(order['amount'])
|
|
amount = order['amount'] if Precise.string_gt(orderAmount, '0') else amount
|
|
order['amount'] = self.parse_number(amount)
|
|
return order
|
|
|
|
def cancel_order(self, id: str, symbol: Str = None, params={}):
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#cancel-order
|
|
|
|
cancels an open order
|
|
:param str id: order id
|
|
:param str symbol: unified symbol of the market the order was made in
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: An `order structure <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
request: dict = {
|
|
'order': id,
|
|
}
|
|
response = self.privatePostOrderCancel(self.extend(request, params))
|
|
#
|
|
# {
|
|
# "order": 63568
|
|
# }
|
|
#
|
|
return self.parse_order(response)
|
|
|
|
def fetch_order(self, id: str, symbol: Str = None, params={}):
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#retrieve-single-order
|
|
|
|
fetches information on an order made by the user
|
|
:param str id: the order id
|
|
:param str symbol: not used by btcalpha fetchOrder
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns dict: An `order structure <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
self.load_markets()
|
|
request: dict = {
|
|
'id': id,
|
|
}
|
|
order = self.privateGetOrderId(self.extend(request, params))
|
|
return self.parse_order(order)
|
|
|
|
def fetch_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
|
|
"""
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-orders
|
|
|
|
fetches information on multiple orders made by the user
|
|
:param str symbol: unified market symbol of the market orders were made in
|
|
:param int [since]: the earliest time in ms to fetch orders for
|
|
:param int [limit]: the maximum number of order structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
self.load_markets()
|
|
request: dict = {}
|
|
market = None
|
|
if symbol is not None:
|
|
market = self.market(symbol)
|
|
request['pair'] = market['id']
|
|
if limit is not None:
|
|
request['limit'] = limit
|
|
orders = self.privateGetOrdersOwn(self.extend(request, params))
|
|
return self.parse_orders(orders, market, since, limit)
|
|
|
|
def fetch_open_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
|
|
"""
|
|
fetch all unfilled currently open orders
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-orders
|
|
|
|
:param str symbol: unified market symbol
|
|
:param int [since]: the earliest time in ms to fetch open orders for
|
|
:param int [limit]: the maximum number of open orders structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
request: dict = {
|
|
'status': '1',
|
|
}
|
|
return self.fetch_orders(symbol, since, limit, self.extend(request, params))
|
|
|
|
def fetch_closed_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
|
|
"""
|
|
fetches information on multiple closed orders made by the user
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-orders
|
|
|
|
:param str symbol: unified market symbol of the market orders were made in
|
|
:param int [since]: the earliest time in ms to fetch orders for
|
|
:param int [limit]: the maximum number of order structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns Order[]: a list of `order structures <https://docs.ccxt.com/#/?id=order-structure>`
|
|
"""
|
|
request: dict = {
|
|
'status': '3',
|
|
}
|
|
return self.fetch_orders(symbol, since, limit, self.extend(request, params))
|
|
|
|
def fetch_my_trades(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
|
|
"""
|
|
fetch all trades made by the user
|
|
|
|
https://btc-alpha.github.io/api-docs/#list-own-exchanges
|
|
|
|
:param str symbol: unified market symbol
|
|
:param int [since]: the earliest time in ms to fetch trades for
|
|
:param int [limit]: the maximum number of trades structures to retrieve
|
|
:param dict [params]: extra parameters specific to the exchange API endpoint
|
|
:returns Trade[]: a list of `trade structures <https://docs.ccxt.com/#/?id=trade-structure>`
|
|
"""
|
|
self.load_markets()
|
|
request: dict = {}
|
|
if symbol is not None:
|
|
market = self.market(symbol)
|
|
request['pair'] = market['id']
|
|
if limit is not None:
|
|
request['limit'] = limit
|
|
trades = self.privateGetExchangesOwn(self.extend(request, params))
|
|
return self.parse_trades(trades, None, since, limit)
|
|
|
|
def nonce(self):
|
|
return self.milliseconds()
|
|
|
|
def sign(self, path, api='public', method='GET', params={}, headers=None, body=None):
|
|
query = self.urlencode(self.keysort(self.omit(params, self.extract_params(path))))
|
|
url = self.urls['api']['rest'] + '/'
|
|
if path != 'charts/{pair}/{type}/chart/':
|
|
url += 'v1/'
|
|
url += self.implode_params(path, params)
|
|
headers = {'Accept': 'application/json'}
|
|
if api == 'public':
|
|
if len(query):
|
|
url += '?' + query
|
|
else:
|
|
self.check_required_credentials()
|
|
payload = self.apiKey
|
|
if method == 'POST':
|
|
headers['Content-Type'] = 'application/x-www-form-urlencoded'
|
|
body = query
|
|
payload += body
|
|
elif len(query):
|
|
url += '?' + query
|
|
headers['X-KEY'] = self.apiKey
|
|
headers['X-SIGN'] = self.hmac(self.encode(payload), self.encode(self.secret), hashlib.sha256)
|
|
headers['X-NONCE'] = str(self.nonce())
|
|
return {'url': url, 'method': method, 'body': body, 'headers': headers}
|
|
|
|
def handle_errors(self, code: int, reason: str, url: str, method: str, headers: dict, body: str, response, requestHeaders, requestBody):
|
|
if response is None:
|
|
return None # fallback to default error handler
|
|
#
|
|
# {"date":1570599531.4814300537,"error":"Out of balance -9.99243661 BTC"}
|
|
#
|
|
error = self.safe_string(response, 'error')
|
|
if error is not None:
|
|
feedback = self.id + ' ' + body
|
|
self.throw_exactly_matched_exception(self.exceptions['exact'], error, feedback)
|
|
self.throw_broadly_matched_exception(self.exceptions['broad'], error, feedback)
|
|
raise ExchangeError(feedback) # unknown error
|
|
return None
|